C14H29N7O — CID 111701625
1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-3-[2-[2-methoxyethyl(methyl)amino]ethyl]-2-methylguanidine (PubChem CID 111701625) has the molecular formula C14H29N7O and a molecular weight of 311.43 g/mol. Its IUPAC name is 1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-3-[2-[2-methoxyethyl(methyl)amino]ethyl]-2-methylguanidine.
| Compound Name | 1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-3-[2-[2-methoxyethyl(methyl)amino]ethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111701625 |
| Molecular Formula | C14H29N7O |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.24 |
| IUPAC Name | 1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-3-[2-[2-methoxyethyl(methyl)amino]ethyl]-2-methylguanidine |
| SMILES | CCc1nncn1CCN/C(=N/C)NCCN(C)CCOC |
| InChI | InChI=1S/C14H29N7O/c1-5-13-19-18-12-21(13)9-7-17-14(15-2)16-6-8-20(3)10-11-22-4/h12H,5-11H2,1-4H3,(H2,15,16,17) |
| InChIKey | HEDRXQBCSPWDPL-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 79.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|