C18H27ClIN7O — CID 111700020
N-(4-chlorophenyl)-4-[[N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-N'-methylcarbamimidoyl]amino]butanamide;hydroiodide (PubChem CID 111700020) has the molecular formula C18H27ClIN7O and a molecular weight of 519.82 g/mol. Its IUPAC name is N-(4-chlorophenyl)-4-[[N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-N'-methylcarbamimidoyl]amino]butanamide;hydroiodide.
| Compound Name | N-(4-chlorophenyl)-4-[[N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-N'-methylcarbamimidoyl]amino]butanamide;hydroiodide |
|---|---|
| PubChem CID | 111700020 |
| Molecular Formula | C18H27ClIN7O |
| Molecular Weight | 519.82 g/mol |
| Exact Mass | 519.10 |
| IUPAC Name | N-(4-chlorophenyl)-4-[[N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-N'-methylcarbamimidoyl]amino]butanamide;hydroiodide |
| SMILES | CCc1nncn1CCN/C(=N\C)NCCCC(=O)Nc1ccc(Cl)cc1.I |
| InChI | InChI=1S/C18H26ClN7O.HI/c1-3-16-25-23-13-26(16)12-11-22-18(20-2)21-10-4-5-17(27)24-15-8-6-14(19)7-9-15;/h6-9,13H,3-5,10-12H2,1-2H3,(H,24,27)(H2,20,21,22);1H |
| InChIKey | ZXIGHCFZMMKQMY-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 96.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.82 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|