About N-(4-chlorophenyl)-4-[(N'-methyl-N-propan-2-ylcarbamimidoyl)amino]butanamide;hydroiodide
N-(4-chlorophenyl)-4-[(N'-methyl-N-propan-2-ylcarbamimidoyl)amino]butanamide;hydroiodide (PubChem CID 111124604) has the molecular formula C15H24ClIN4O
and a molecular weight of 438.74 g/mol. Its IUPAC name is N-(4-chlorophenyl)-4-[(N'-methyl-N-propan-2-ylcarbamimidoyl)amino]butanamide;hydroiodide.
Molecular Properties
| Compound Name | N-(4-chlorophenyl)-4-[(N'-methyl-N-propan-2-ylcarbamimidoyl)amino]butanamide;hydroiodide |
| PubChem CID | 111124604 |
| Molecular Formula | C15H24ClIN4O |
| Molecular Weight | 438.74 g/mol |
| Exact Mass | 438.07 |
| IUPAC Name | N-(4-chlorophenyl)-4-[(N'-methyl-N-propan-2-ylcarbamimidoyl)amino]butanamide;hydroiodide |
| SMILES | C/N=C(/NCCCC(=O)Nc1ccc(Cl)cc1)NC(C)C.I |
| InChI | InChI=1S/C15H23ClN4O.HI/c1-11(2)19-15(17-3)18-10-4-5-14(21)20-13-8-6-12(16)7-9-13;/h6-9,11H,4-5,10H2,1-3H3,(H,20,21)(H2,17,18,19);1H |
| InChIKey | IHFNUVABPNOPDF-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 438.74 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze N-(4-chlorophenyl)-4-[(N'-methyl-N-propan-2-ylcarbamimidoyl)amino]butanamide;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-chlorophenyl)-4-[(N'-methyl-N-propan-2-ylcarbamimidoyl)amino]butanamide;hydroiodide?
The IUPAC name of N-(4-chlorophenyl)-4-[(N'-methyl-N-propan-2-ylcarbamimidoyl)amino]butanamide;hydroiodide (CID 111124604) is N-(4-chlorophenyl)-4-[(N'-methyl-N-propan-2-ylcarbamimidoyl)amino]butanamide;hydroiodide.
What is the SMILES notation for N-(4-chlorophenyl)-4-[(N'-methyl-N-propan-2-ylcarbamimidoyl)amino]butanamide;hydroiodide?
The canonical SMILES for N-(4-chlorophenyl)-4-[(N'-methyl-N-propan-2-ylcarbamimidoyl)amino]butanamide;hydroiodide is C/N=C(/NCCCC(=O)Nc1ccc(Cl)cc1)NC(C)C.I.
What is the InChIKey of N-(4-chlorophenyl)-4-[(N'-methyl-N-propan-2-ylcarbamimidoyl)amino]butanamide;hydroiodide?
The InChIKey is IHFNUVABPNOPDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23ClN4O.HI/c1-11(2)19-15(17-3)18-10-4-5-14(21)20-13-8-6-12(16)7-9-13;/h6-9,11H,4-5,10H2,1-3H3,(H,20,21)(H2,17,18,19);1H.
What are the key properties of N-(4-chlorophenyl)-4-[(N'-methyl-N-propan-2-ylcarbamimidoyl)amino]butanamide;hydroiodide?
N-(4-chlorophenyl)-4-[(N'-methyl-N-propan-2-ylcarbamimidoyl)amino]butanamide;hydroiodide has a molecular weight of 438.74 g/mol, XLogP of 3.25, 6 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-chlorophenyl)-4-[(N'-methyl-N-propan-2-ylcarbamimidoyl)amino]butanamide;hydroiodide is sourced from PubChem (CID 111124604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).