C14H21ClN4O — CID 111124785
4-chloro-N-[2-[(N'-methyl-N-propan-2-ylcarbamimidoyl)amino]ethyl]benzamide (PubChem CID 111124785) has the molecular formula C14H21ClN4O and a molecular weight of 296.80 g/mol. Its IUPAC name is 4-chloro-N-[2-[(N'-methyl-N-propan-2-ylcarbamimidoyl)amino]ethyl]benzamide.
| Compound Name | 4-chloro-N-[2-[(N'-methyl-N-propan-2-ylcarbamimidoyl)amino]ethyl]benzamide |
|---|---|
| PubChem CID | 111124785 |
| Molecular Formula | C14H21ClN4O |
| Molecular Weight | 296.80 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | 4-chloro-N-[2-[(N'-methyl-N-propan-2-ylcarbamimidoyl)amino]ethyl]benzamide |
| SMILES | C/N=C(/NCCNC(=O)c1ccc(Cl)cc1)NC(C)C |
| InChI | InChI=1S/C14H21ClN4O/c1-10(2)19-14(16-3)18-9-8-17-13(20)11-4-6-12(15)7-5-11/h4-7,10H,8-9H2,1-3H3,(H,17,20)(H2,16,18,19) |
| InChIKey | RCOMGWHCCCARIH-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.80 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|