C16H26ClIN4O2 — CID 111222904
4-chloro-N-[2-[[N-(3-ethoxypropyl)-N'-methylcarbamimidoyl]amino]ethyl]benzamide;hydroiodide (PubChem CID 111222904) has the molecular formula C16H26ClIN4O2 and a molecular weight of 468.77 g/mol. Its IUPAC name is 4-chloro-N-[2-[[N-(3-ethoxypropyl)-N'-methylcarbamimidoyl]amino]ethyl]benzamide;hydroiodide.
| Compound Name | 4-chloro-N-[2-[[N-(3-ethoxypropyl)-N'-methylcarbamimidoyl]amino]ethyl]benzamide;hydroiodide |
|---|---|
| PubChem CID | 111222904 |
| Molecular Formula | C16H26ClIN4O2 |
| Molecular Weight | 468.77 g/mol |
| Exact Mass | 468.08 |
| IUPAC Name | 4-chloro-N-[2-[[N-(3-ethoxypropyl)-N'-methylcarbamimidoyl]amino]ethyl]benzamide;hydroiodide |
| SMILES | CCOCCCN/C(=N\C)NCCNC(=O)c1ccc(Cl)cc1.I |
| InChI | InChI=1S/C16H25ClN4O2.HI/c1-3-23-12-4-9-20-16(18-2)21-11-10-19-15(22)13-5-7-14(17)8-6-13;/h5-8H,3-4,9-12H2,1-2H3,(H,19,22)(H2,18,20,21);1H |
| InChIKey | AASZDRNNUDZURN-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.77 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|