C18H29ClN4O2 — CID 111945195
N-(4-chlorophenyl)-4-[[N-(4-ethoxybutyl)-N'-methylcarbamimidoyl]amino]butanamide (PubChem CID 111945195) has the molecular formula C18H29ClN4O2 and a molecular weight of 368.91 g/mol. Its IUPAC name is N-(4-chlorophenyl)-4-[[N-(4-ethoxybutyl)-N'-methylcarbamimidoyl]amino]butanamide.
| Compound Name | N-(4-chlorophenyl)-4-[[N-(4-ethoxybutyl)-N'-methylcarbamimidoyl]amino]butanamide |
|---|---|
| PubChem CID | 111945195 |
| Molecular Formula | C18H29ClN4O2 |
| Molecular Weight | 368.91 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | N-(4-chlorophenyl)-4-[[N-(4-ethoxybutyl)-N'-methylcarbamimidoyl]amino]butanamide |
| SMILES | CCOCCCCN/C(=N\C)NCCCC(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H29ClN4O2/c1-3-25-14-5-4-12-21-18(20-2)22-13-6-7-17(24)23-16-10-8-15(19)9-11-16/h8-11H,3-7,12-14H2,1-2H3,(H,23,24)(H2,20,21,22) |
| InChIKey | GGWNVLXEPIQYJT-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.91 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|