C15H22ClIN4O — CID 110981118
N-(4-chlorophenyl)-4-[(N'-methyl-N-prop-2-enylcarbamimidoyl)amino]butanamide;hydroiodide (PubChem CID 110981118) has the molecular formula C15H22ClIN4O and a molecular weight of 436.73 g/mol. Its IUPAC name is N-(4-chlorophenyl)-4-[(N'-methyl-N-prop-2-enylcarbamimidoyl)amino]butanamide;hydroiodide.
| Compound Name | N-(4-chlorophenyl)-4-[(N'-methyl-N-prop-2-enylcarbamimidoyl)amino]butanamide;hydroiodide |
|---|---|
| PubChem CID | 110981118 |
| Molecular Formula | C15H22ClIN4O |
| Molecular Weight | 436.73 g/mol |
| Exact Mass | 436.05 |
| IUPAC Name | N-(4-chlorophenyl)-4-[(N'-methyl-N-prop-2-enylcarbamimidoyl)amino]butanamide;hydroiodide |
| SMILES | C=CCN/C(=N\C)NCCCC(=O)Nc1ccc(Cl)cc1.I |
| InChI | InChI=1S/C15H21ClN4O.HI/c1-3-10-18-15(17-2)19-11-4-5-14(21)20-13-8-6-12(16)7-9-13;/h3,6-9H,1,4-5,10-11H2,2H3,(H,20,21)(H2,17,18,19);1H |
| InChIKey | YOFDTYJVXJRESE-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.73 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|