C14H19ClN2O4S — CID 94825681
N-(4-chlorophenyl)-4-[[(2S)-2-methylsulfonylpropanoyl]amino]butanamide (PubChem CID 94825681) has the molecular formula C14H19ClN2O4S and a molecular weight of 346.84 g/mol. Its IUPAC name is N-(4-chlorophenyl)-4-[[(2S)-2-methylsulfonylpropanoyl]amino]butanamide.
| Compound Name | N-(4-chlorophenyl)-4-[[(2S)-2-methylsulfonylpropanoyl]amino]butanamide |
|---|---|
| PubChem CID | 94825681 |
| Molecular Formula | C14H19ClN2O4S |
| Molecular Weight | 346.84 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | N-(4-chlorophenyl)-4-[[(2S)-2-methylsulfonylpropanoyl]amino]butanamide |
| SMILES | C[C@@H](C(=O)NCCCC(=O)Nc1ccc(Cl)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C14H19ClN2O4S/c1-10(22(2,20)21)14(19)16-9-3-4-13(18)17-12-7-5-11(15)6-8-12/h5-8,10H,3-4,9H2,1-2H3,(H,16,19)(H,17,18)/t10-/m0/s1 |
| InChIKey | UTWUVWOSJNWPHG-JTQLQIEISA-N |
| XLogP | 1.61 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.84 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|