C18H19Cl2N3O2 — CID 60544636
N-(4-chlorophenyl)-4-[(2-chlorophenyl)methylcarbamoylamino]butanamide (PubChem CID 60544636) has the molecular formula C18H19Cl2N3O2 and a molecular weight of 380.28 g/mol. Its IUPAC name is N-(4-chlorophenyl)-4-[(2-chlorophenyl)methylcarbamoylamino]butanamide.
| Compound Name | N-(4-chlorophenyl)-4-[(2-chlorophenyl)methylcarbamoylamino]butanamide |
|---|---|
| PubChem CID | 60544636 |
| Molecular Formula | C18H19Cl2N3O2 |
| Molecular Weight | 380.28 g/mol |
| Exact Mass | 379.09 |
| IUPAC Name | N-(4-chlorophenyl)-4-[(2-chlorophenyl)methylcarbamoylamino]butanamide |
| SMILES | O=C(CCCNC(=O)NCc1ccccc1Cl)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H19Cl2N3O2/c19-14-7-9-15(10-8-14)23-17(24)6-3-11-21-18(25)22-12-13-4-1-2-5-16(13)20/h1-2,4-5,7-10H,3,6,11-12H2,(H,23,24)(H2,21,22,25) |
| InChIKey | OJGHEJPQSIQYOB-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.28 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|