C16H16Cl2N2O2 — CID 112970907
1-[2-(4-chlorophenoxy)ethyl]-3-[(2-chlorophenyl)methyl]urea (PubChem CID 112970907) has the molecular formula C16H16Cl2N2O2 and a molecular weight of 339.22 g/mol. Its IUPAC name is 1-[2-(4-chlorophenoxy)ethyl]-3-[(2-chlorophenyl)methyl]urea.
| Compound Name | 1-[2-(4-chlorophenoxy)ethyl]-3-[(2-chlorophenyl)methyl]urea |
|---|---|
| PubChem CID | 112970907 |
| Molecular Formula | C16H16Cl2N2O2 |
| Molecular Weight | 339.22 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | 1-[2-(4-chlorophenoxy)ethyl]-3-[(2-chlorophenyl)methyl]urea |
| SMILES | O=C(NCCOc1ccc(Cl)cc1)NCc1ccccc1Cl |
| InChI | InChI=1S/C16H16Cl2N2O2/c17-13-5-7-14(8-6-13)22-10-9-19-16(21)20-11-12-3-1-2-4-15(12)18/h1-8H,9-11H2,(H2,19,20,21) |
| InChIKey | ULQIGPXNSGMXHQ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.22 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|