C17H18F2N2O3 — CID 111435092
1-[2-(3,4-difluorophenoxy)ethyl]-3-[[2-(hydroxymethyl)phenyl]methyl]urea (PubChem CID 111435092) has the molecular formula C17H18F2N2O3 and a molecular weight of 336.34 g/mol. Its IUPAC name is 1-[2-(3,4-difluorophenoxy)ethyl]-3-[[2-(hydroxymethyl)phenyl]methyl]urea.
| Compound Name | 1-[2-(3,4-difluorophenoxy)ethyl]-3-[[2-(hydroxymethyl)phenyl]methyl]urea |
|---|---|
| PubChem CID | 111435092 |
| Molecular Formula | C17H18F2N2O3 |
| Molecular Weight | 336.34 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | 1-[2-(3,4-difluorophenoxy)ethyl]-3-[[2-(hydroxymethyl)phenyl]methyl]urea |
| SMILES | O=C(NCCOc1ccc(F)c(F)c1)NCc1ccccc1CO |
| InChI | InChI=1S/C17H18F2N2O3/c18-15-6-5-14(9-16(15)19)24-8-7-20-17(23)21-10-12-3-1-2-4-13(12)11-22/h1-6,9,22H,7-8,10-11H2,(H2,20,21,23) |
| InChIKey | SMYRPDNKAIFBCY-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.34 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|