C13H19ClF2N2O2 — CID 120500595
3-amino-N-[2-(3,4-difluorophenoxy)ethyl]-2-methylbutanamide;hydrochloride (PubChem CID 120500595) has the molecular formula C13H19ClF2N2O2 and a molecular weight of 308.76 g/mol. Its IUPAC name is 3-amino-N-[2-(3,4-difluorophenoxy)ethyl]-2-methylbutanamide;hydrochloride.
| Compound Name | 3-amino-N-[2-(3,4-difluorophenoxy)ethyl]-2-methylbutanamide;hydrochloride |
|---|---|
| PubChem CID | 120500595 |
| Molecular Formula | C13H19ClF2N2O2 |
| Molecular Weight | 308.76 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | 3-amino-N-[2-(3,4-difluorophenoxy)ethyl]-2-methylbutanamide;hydrochloride |
| SMILES | CC(N)C(C)C(=O)NCCOc1ccc(F)c(F)c1.Cl |
| InChI | InChI=1S/C13H18F2N2O2.ClH/c1-8(9(2)16)13(18)17-5-6-19-10-3-4-11(14)12(15)7-10;/h3-4,7-9H,5-6,16H2,1-2H3,(H,17,18);1H |
| InChIKey | IXTACWLTEKVMNK-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.76 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|