C18H20F2N2O2 — CID 112976375
1-[2-(3,4-difluorophenoxy)ethyl]-3-(4-propan-2-ylphenyl)urea (PubChem CID 112976375) has the molecular formula C18H20F2N2O2 and a molecular weight of 334.37 g/mol. Its IUPAC name is 1-[2-(3,4-difluorophenoxy)ethyl]-3-(4-propan-2-ylphenyl)urea.
| Compound Name | 1-[2-(3,4-difluorophenoxy)ethyl]-3-(4-propan-2-ylphenyl)urea |
|---|---|
| PubChem CID | 112976375 |
| Molecular Formula | C18H20F2N2O2 |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | 1-[2-(3,4-difluorophenoxy)ethyl]-3-(4-propan-2-ylphenyl)urea |
| SMILES | CC(C)c1ccc(NC(=O)NCCOc2ccc(F)c(F)c2)cc1 |
| InChI | InChI=1S/C18H20F2N2O2/c1-12(2)13-3-5-14(6-4-13)22-18(23)21-9-10-24-15-7-8-16(19)17(20)11-15/h3-8,11-12H,9-10H2,1-2H3,(H2,21,22,23) |
| InChIKey | XPHWYOKDCQHVKN-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|