C16H13F5N2O2 — CID 112976406
1-[2-(3,4-difluorophenoxy)ethyl]-3-[3-(trifluoromethyl)phenyl]urea (PubChem CID 112976406) has the molecular formula C16H13F5N2O2 and a molecular weight of 360.28 g/mol. Its IUPAC name is 1-[2-(3,4-difluorophenoxy)ethyl]-3-[3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[2-(3,4-difluorophenoxy)ethyl]-3-[3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 112976406 |
| Molecular Formula | C16H13F5N2O2 |
| Molecular Weight | 360.28 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | 1-[2-(3,4-difluorophenoxy)ethyl]-3-[3-(trifluoromethyl)phenyl]urea |
| SMILES | O=C(NCCOc1ccc(F)c(F)c1)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H13F5N2O2/c17-13-5-4-12(9-14(13)18)25-7-6-22-15(24)23-11-3-1-2-10(8-11)16(19,20)21/h1-5,8-9H,6-7H2,(H2,22,23,24) |
| InChIKey | MSVSLKCEGBMNHR-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.28 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|