C18H19F3N2O2 — CID 112973376
1-[2-(2,6-dimethylphenoxy)ethyl]-3-[3-(trifluoromethyl)phenyl]urea (PubChem CID 112973376) has the molecular formula C18H19F3N2O2 and a molecular weight of 352.36 g/mol. Its IUPAC name is 1-[2-(2,6-dimethylphenoxy)ethyl]-3-[3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[2-(2,6-dimethylphenoxy)ethyl]-3-[3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 112973376 |
| Molecular Formula | C18H19F3N2O2 |
| Molecular Weight | 352.36 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | 1-[2-(2,6-dimethylphenoxy)ethyl]-3-[3-(trifluoromethyl)phenyl]urea |
| SMILES | Cc1cccc(C)c1OCCNC(=O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H19F3N2O2/c1-12-5-3-6-13(2)16(12)25-10-9-22-17(24)23-15-8-4-7-14(11-15)18(19,20)21/h3-8,11H,9-10H2,1-2H3,(H2,22,23,24) |
| InChIKey | LYABSOKVNBBQLW-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.36 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|