C15H13Cl2F2N3O2 — CID 86807501
1-(4-amino-3,5-dichlorophenyl)-3-[2-(3,4-difluorophenoxy)ethyl]urea (PubChem CID 86807501) has the molecular formula C15H13Cl2F2N3O2 and a molecular weight of 376.19 g/mol. Its IUPAC name is 1-(4-amino-3,5-dichlorophenyl)-3-[2-(3,4-difluorophenoxy)ethyl]urea.
| Compound Name | 1-(4-amino-3,5-dichlorophenyl)-3-[2-(3,4-difluorophenoxy)ethyl]urea |
|---|---|
| PubChem CID | 86807501 |
| Molecular Formula | C15H13Cl2F2N3O2 |
| Molecular Weight | 376.19 g/mol |
| Exact Mass | 375.04 |
| IUPAC Name | 1-(4-amino-3,5-dichlorophenyl)-3-[2-(3,4-difluorophenoxy)ethyl]urea |
| SMILES | Nc1c(Cl)cc(NC(=O)NCCOc2ccc(F)c(F)c2)cc1Cl |
| InChI | InChI=1S/C15H13Cl2F2N3O2/c16-10-5-8(6-11(17)14(10)20)22-15(23)21-3-4-24-9-1-2-12(18)13(19)7-9/h1-2,5-7H,3-4,20H2,(H2,21,22,23) |
| InChIKey | DNXXNBURNSABJY-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.19 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|