C15H12Cl2F2N2O2 — CID 112976443
1-(2,4-dichlorophenyl)-3-[2-(3,4-difluorophenoxy)ethyl]urea (PubChem CID 112976443) has the molecular formula C15H12Cl2F2N2O2 and a molecular weight of 361.18 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-3-[2-(3,4-difluorophenoxy)ethyl]urea.
| Compound Name | 1-(2,4-dichlorophenyl)-3-[2-(3,4-difluorophenoxy)ethyl]urea |
|---|---|
| PubChem CID | 112976443 |
| Molecular Formula | C15H12Cl2F2N2O2 |
| Molecular Weight | 361.18 g/mol |
| Exact Mass | 360.02 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-3-[2-(3,4-difluorophenoxy)ethyl]urea |
| SMILES | O=C(NCCOc1ccc(F)c(F)c1)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H12Cl2F2N2O2/c16-9-1-4-14(11(17)7-9)21-15(22)20-5-6-23-10-2-3-12(18)13(19)8-10/h1-4,7-8H,5-6H2,(H2,20,21,22) |
| InChIKey | RVBFXBNEMOOHJR-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.18 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|