C12H20Cl3N3O2 — CID 120504370
3-amino-N-[2-[(5-chloro-2-pyridinyl)oxy]ethyl]-2-methylbutanamide;dihydrochloride (PubChem CID 120504370) has the molecular formula C12H20Cl3N3O2 and a molecular weight of 344.67 g/mol. Its IUPAC name is 3-amino-N-[2-[(5-chloro-2-pyridinyl)oxy]ethyl]-2-methylbutanamide;dihydrochloride.
| Compound Name | 3-amino-N-[2-[(5-chloro-2-pyridinyl)oxy]ethyl]-2-methylbutanamide;dihydrochloride |
|---|---|
| PubChem CID | 120504370 |
| Molecular Formula | C12H20Cl3N3O2 |
| Molecular Weight | 344.67 g/mol |
| Exact Mass | 343.06 |
| IUPAC Name | 3-amino-N-[2-[(5-chloro-2-pyridinyl)oxy]ethyl]-2-methylbutanamide;dihydrochloride |
| SMILES | CC(N)C(C)C(=O)NCCOc1ccc(Cl)cn1.Cl.Cl |
| InChI | InChI=1S/C12H18ClN3O2.2ClH/c1-8(9(2)14)12(17)15-5-6-18-11-4-3-10(13)7-16-11;;/h3-4,7-9H,5-6,14H2,1-2H3,(H,15,17);2*1H |
| InChIKey | YKKPUYAGYZKHAM-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.67 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|