C14H24Cl3N3O2 — CID 119900741
7-amino-N-[2-[(5-chloro-2-pyridinyl)oxy]ethyl]heptanamide;dihydrochloride (PubChem CID 119900741) has the molecular formula C14H24Cl3N3O2 and a molecular weight of 372.72 g/mol. Its IUPAC name is 7-amino-N-[2-[(5-chloro-2-pyridinyl)oxy]ethyl]heptanamide;dihydrochloride.
| Compound Name | 7-amino-N-[2-[(5-chloro-2-pyridinyl)oxy]ethyl]heptanamide;dihydrochloride |
|---|---|
| PubChem CID | 119900741 |
| Molecular Formula | C14H24Cl3N3O2 |
| Molecular Weight | 372.72 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | 7-amino-N-[2-[(5-chloro-2-pyridinyl)oxy]ethyl]heptanamide;dihydrochloride |
| SMILES | Cl.Cl.NCCCCCCC(=O)NCCOc1ccc(Cl)cn1 |
| InChI | InChI=1S/C14H22ClN3O2.2ClH/c15-12-6-7-14(18-11-12)20-10-9-17-13(19)5-3-1-2-4-8-16;;/h6-7,11H,1-5,8-10,16H2,(H,17,19);2*1H |
| InChIKey | DKTJJAUGOAAUJW-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.72 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|