C12H20Cl3N3O3 — CID 120597522
4-amino-N-[2-[(5-chloro-2-pyridinyl)oxy]ethyl]-3-methoxybutanamide;dihydrochloride (PubChem CID 120597522) has the molecular formula C12H20Cl3N3O3 and a molecular weight of 360.67 g/mol. Its IUPAC name is 4-amino-N-[2-[(5-chloro-2-pyridinyl)oxy]ethyl]-3-methoxybutanamide;dihydrochloride.
| Compound Name | 4-amino-N-[2-[(5-chloro-2-pyridinyl)oxy]ethyl]-3-methoxybutanamide;dihydrochloride |
|---|---|
| PubChem CID | 120597522 |
| Molecular Formula | C12H20Cl3N3O3 |
| Molecular Weight | 360.67 g/mol |
| Exact Mass | 359.06 |
| IUPAC Name | 4-amino-N-[2-[(5-chloro-2-pyridinyl)oxy]ethyl]-3-methoxybutanamide;dihydrochloride |
| SMILES | COC(CN)CC(=O)NCCOc1ccc(Cl)cn1.Cl.Cl |
| InChI | InChI=1S/C12H18ClN3O3.2ClH/c1-18-10(7-14)6-11(17)15-4-5-19-12-3-2-9(13)8-16-12;;/h2-3,8,10H,4-7,14H2,1H3,(H,15,17);2*1H |
| InChIKey | YSYAVQYSSDCTGX-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.67 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|