C14H20ClF3N2O3 — CID 120589465
4-amino-3-methoxy-N-[2-[4-(trifluoromethyl)phenoxy]ethyl]butanamide;hydrochloride (PubChem CID 120589465) has the molecular formula C14H20ClF3N2O3 and a molecular weight of 356.77 g/mol. Its IUPAC name is 4-amino-3-methoxy-N-[2-[4-(trifluoromethyl)phenoxy]ethyl]butanamide;hydrochloride.
| Compound Name | 4-amino-3-methoxy-N-[2-[4-(trifluoromethyl)phenoxy]ethyl]butanamide;hydrochloride |
|---|---|
| PubChem CID | 120589465 |
| Molecular Formula | C14H20ClF3N2O3 |
| Molecular Weight | 356.77 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | 4-amino-3-methoxy-N-[2-[4-(trifluoromethyl)phenoxy]ethyl]butanamide;hydrochloride |
| SMILES | COC(CN)CC(=O)NCCOc1ccc(C(F)(F)F)cc1.Cl |
| InChI | InChI=1S/C14H19F3N2O3.ClH/c1-21-12(9-18)8-13(20)19-6-7-22-11-4-2-10(3-5-11)14(15,16)17;/h2-5,12H,6-9,18H2,1H3,(H,19,20);1H |
| InChIKey | OZLLPNWVIIXPEA-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.77 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|