C14H11ClF2N2O2 — CID 129392827
N-[2-[(5-chloro-2-pyridinyl)oxy]ethyl]-2,6-difluorobenzamide (PubChem CID 129392827) has the molecular formula C14H11ClF2N2O2 and a molecular weight of 312.70 g/mol. Its IUPAC name is N-[2-[(5-chloro-2-pyridinyl)oxy]ethyl]-2,6-difluorobenzamide.
| Compound Name | N-[2-[(5-chloro-2-pyridinyl)oxy]ethyl]-2,6-difluorobenzamide |
|---|---|
| PubChem CID | 129392827 |
| Molecular Formula | C14H11ClF2N2O2 |
| Molecular Weight | 312.70 g/mol |
| Exact Mass | 312.05 |
| IUPAC Name | N-[2-[(5-chloro-2-pyridinyl)oxy]ethyl]-2,6-difluorobenzamide |
| SMILES | O=C(NCCOc1ccc(Cl)cn1)c1c(F)cccc1F |
| InChI | InChI=1S/C14H11ClF2N2O2/c15-9-4-5-12(19-8-9)21-7-6-18-14(20)13-10(16)2-1-3-11(13)17/h1-5,8H,6-7H2,(H,18,20) |
| InChIKey | NKCWCPWZOMGPEF-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.70 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|