C15H12F4N2O2 — CID 129392878
2-fluoro-N-[2-[[5-(trifluoromethyl)-2-pyridinyl]oxy]ethyl]benzamide (PubChem CID 129392878) has the molecular formula C15H12F4N2O2 and a molecular weight of 328.26 g/mol. Its IUPAC name is 2-fluoro-N-[2-[[5-(trifluoromethyl)-2-pyridinyl]oxy]ethyl]benzamide.
| Compound Name | 2-fluoro-N-[2-[[5-(trifluoromethyl)-2-pyridinyl]oxy]ethyl]benzamide |
|---|---|
| PubChem CID | 129392878 |
| Molecular Formula | C15H12F4N2O2 |
| Molecular Weight | 328.26 g/mol |
| Exact Mass | 328.08 |
| IUPAC Name | 2-fluoro-N-[2-[[5-(trifluoromethyl)-2-pyridinyl]oxy]ethyl]benzamide |
| SMILES | O=C(NCCOc1ccc(C(F)(F)F)cn1)c1ccccc1F |
| InChI | InChI=1S/C15H12F4N2O2/c16-12-4-2-1-3-11(12)14(22)20-7-8-23-13-6-5-10(9-21-13)15(17,18)19/h1-6,9H,7-8H2,(H,20,22) |
| InChIKey | VVJQUJUDTWILHB-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.26 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|