C15H11ClF3IN2O2 — CID 74767005
N-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]ethyl]-2-iodobenzamide (PubChem CID 74767005) has the molecular formula C15H11ClF3IN2O2 and a molecular weight of 470.62 g/mol. Its IUPAC name is N-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]ethyl]-2-iodobenzamide.
| Compound Name | N-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]ethyl]-2-iodobenzamide |
|---|---|
| PubChem CID | 74767005 |
| Molecular Formula | C15H11ClF3IN2O2 |
| Molecular Weight | 470.62 g/mol |
| Exact Mass | 469.95 |
| IUPAC Name | N-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]ethyl]-2-iodobenzamide |
| SMILES | O=C(NCCOc1ncc(C(F)(F)F)cc1Cl)c1ccccc1I |
| InChI | InChI=1S/C15H11ClF3IN2O2/c16-11-7-9(15(17,18)19)8-22-14(11)24-6-5-21-13(23)10-3-1-2-4-12(10)20/h1-4,7-8H,5-6H2,(H,21,23) |
| InChIKey | KHMGIOHEQJMXFO-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.62 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|