C12H17Cl3F3N3O2 — CID 119893789
3-amino-N-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]ethyl]butanamide;dihydrochloride (PubChem CID 119893789) has the molecular formula C12H17Cl3F3N3O2 and a molecular weight of 398.64 g/mol. Its IUPAC name is 3-amino-N-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]ethyl]butanamide;dihydrochloride.
| Compound Name | 3-amino-N-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]ethyl]butanamide;dihydrochloride |
|---|---|
| PubChem CID | 119893789 |
| Molecular Formula | C12H17Cl3F3N3O2 |
| Molecular Weight | 398.64 g/mol |
| Exact Mass | 397.03 |
| IUPAC Name | 3-amino-N-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]ethyl]butanamide;dihydrochloride |
| SMILES | CC(N)CC(=O)NCCOc1ncc(C(F)(F)F)cc1Cl.Cl.Cl |
| InChI | InChI=1S/C12H15ClF3N3O2.2ClH/c1-7(17)4-10(20)18-2-3-21-11-9(13)5-8(6-19-11)12(14,15)16;;/h5-7H,2-4,17H2,1H3,(H,18,20);2*1H |
| InChIKey | NJAYJSUSLKEMAP-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.64 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|