C13H15ClF3N3O4 — CID 122003521
4-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]ethylcarbamoylamino]butanoic acid (PubChem CID 122003521) has the molecular formula C13H15ClF3N3O4 and a molecular weight of 369.73 g/mol. Its IUPAC name is 4-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]ethylcarbamoylamino]butanoic acid.
| Compound Name | 4-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]ethylcarbamoylamino]butanoic acid |
|---|---|
| PubChem CID | 122003521 |
| Molecular Formula | C13H15ClF3N3O4 |
| Molecular Weight | 369.73 g/mol |
| Exact Mass | 369.07 |
| IUPAC Name | 4-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]ethylcarbamoylamino]butanoic acid |
| SMILES | O=C(O)CCCNC(=O)NCCOc1ncc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C13H15ClF3N3O4/c14-9-6-8(13(15,16)17)7-20-11(9)24-5-4-19-12(23)18-3-1-2-10(21)22/h6-7H,1-5H2,(H,21,22)(H2,18,19,23) |
| InChIKey | DRHYTQLTQQAGOE-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.73 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|