C10H13Cl3F3N3O2 — CID 119893779
2-amino-N-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]ethyl]acetamide;dihydrochloride (PubChem CID 119893779) has the molecular formula C10H13Cl3F3N3O2 and a molecular weight of 370.59 g/mol. Its IUPAC name is 2-amino-N-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]ethyl]acetamide;dihydrochloride.
| Compound Name | 2-amino-N-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]ethyl]acetamide;dihydrochloride |
|---|---|
| PubChem CID | 119893779 |
| Molecular Formula | C10H13Cl3F3N3O2 |
| Molecular Weight | 370.59 g/mol |
| Exact Mass | 369.00 |
| IUPAC Name | 2-amino-N-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]ethyl]acetamide;dihydrochloride |
| SMILES | Cl.Cl.NCC(=O)NCCOc1ncc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C10H11ClF3N3O2.2ClH/c11-7-3-6(10(12,13)14)5-17-9(7)19-2-1-16-8(18)4-15;;/h3,5H,1-2,4,15H2,(H,16,18);2*1H |
| InChIKey | PTCOMGCGAOPCOG-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.59 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|