C13H17Cl3F3N3O3 — CID 119893791
N-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]ethyl]morpholine-2-carboxamide;dihydrochloride (PubChem CID 119893791) has the molecular formula C13H17Cl3F3N3O3 and a molecular weight of 426.65 g/mol. Its IUPAC name is N-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]ethyl]morpholine-2-carboxamide;dihydrochloride.
| Compound Name | N-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]ethyl]morpholine-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119893791 |
| Molecular Formula | C13H17Cl3F3N3O3 |
| Molecular Weight | 426.65 g/mol |
| Exact Mass | 425.03 |
| IUPAC Name | N-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]ethyl]morpholine-2-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(NCCOc1ncc(C(F)(F)F)cc1Cl)C1CNCCO1 |
| InChI | InChI=1S/C13H15ClF3N3O3.2ClH/c14-9-5-8(13(15,16)17)6-20-12(9)23-4-2-19-11(21)10-7-18-1-3-22-10;;/h5-6,10,18H,1-4,7H2,(H,19,21);2*1H |
| InChIKey | BOMGVXKTROVFIV-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.65 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|