C16H21ClF3N3O4 — CID 71909048
tert-butyl N-[2-[3-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]propylamino]-2-oxoethyl]carbamate (PubChem CID 71909048) has the molecular formula C16H21ClF3N3O4 and a molecular weight of 411.81 g/mol. Its IUPAC name is tert-butyl N-[2-[3-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]propylamino]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[3-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]propylamino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 71909048 |
| Molecular Formula | C16H21ClF3N3O4 |
| Molecular Weight | 411.81 g/mol |
| Exact Mass | 411.12 |
| IUPAC Name | tert-butyl N-[2-[3-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]propylamino]-2-oxoethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(=O)NCCCOc1ncc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C16H21ClF3N3O4/c1-15(2,3)27-14(25)23-9-12(24)21-5-4-6-26-13-11(17)7-10(8-22-13)16(18,19)20/h7-8H,4-6,9H2,1-3H3,(H,21,24)(H,23,25) |
| InChIKey | ZAUZEKWUQWOFRT-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.81 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|