C17H17ClF3N5O3 — CID 142503835
N-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]ethyl]-6-methyl-2-(propanoylamino)pyrimidine-4-carboxamide (PubChem CID 142503835) has the molecular formula C17H17ClF3N5O3 and a molecular weight of 431.80 g/mol. Its IUPAC name is N-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]ethyl]-6-methyl-2-(propanoylamino)pyrimidine-4-carboxamide.
| Compound Name | N-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]ethyl]-6-methyl-2-(propanoylamino)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 142503835 |
| Molecular Formula | C17H17ClF3N5O3 |
| Molecular Weight | 431.80 g/mol |
| Exact Mass | 431.10 |
| IUPAC Name | N-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]ethyl]-6-methyl-2-(propanoylamino)pyrimidine-4-carboxamide |
| SMILES | CCC(=O)Nc1nc(C)cc(C(=O)NCCOc2ncc(C(F)(F)F)cc2Cl)n1 |
| InChI | InChI=1S/C17H17ClF3N5O3/c1-3-13(27)26-16-24-9(2)6-12(25-16)14(28)22-4-5-29-15-11(18)7-10(8-23-15)17(19,20)21/h6-8H,3-5H2,1-2H3,(H,22,28)(H,24,25,26,27) |
| InChIKey | WCTUYTFAAOJGKU-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 106.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.80 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|