C18H19ClF3N5O2 — CID 142503751
N-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-2-methyl-6-(propanoylamino)pyridine-4-carboxamide (PubChem CID 142503751) has the molecular formula C18H19ClF3N5O2 and a molecular weight of 429.83 g/mol. Its IUPAC name is N-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-2-methyl-6-(propanoylamino)pyridine-4-carboxamide.
| Compound Name | N-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-2-methyl-6-(propanoylamino)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 142503751 |
| Molecular Formula | C18H19ClF3N5O2 |
| Molecular Weight | 429.83 g/mol |
| Exact Mass | 429.12 |
| IUPAC Name | N-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-2-methyl-6-(propanoylamino)pyridine-4-carboxamide |
| SMILES | CCC(=O)Nc1cc(C(=O)NCCNc2ncc(C(F)(F)F)cc2Cl)cc(C)n1 |
| InChI | InChI=1S/C18H19ClF3N5O2/c1-3-15(28)27-14-7-11(6-10(2)26-14)17(29)24-5-4-23-16-13(19)8-12(9-25-16)18(20,21)22/h6-9H,3-5H2,1-2H3,(H,23,25)(H,24,29)(H,26,27,28) |
| InChIKey | GYTMBPHCXOSXIB-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.83 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|