C19H19ClF3N3O3 — CID 142503824
N-[2-[4-chloro-3-(trifluoromethyl)phenoxy]ethyl]-2-methyl-6-(propanoylamino)pyridine-4-carboxamide (PubChem CID 142503824) has the molecular formula C19H19ClF3N3O3 and a molecular weight of 429.83 g/mol. Its IUPAC name is N-[2-[4-chloro-3-(trifluoromethyl)phenoxy]ethyl]-2-methyl-6-(propanoylamino)pyridine-4-carboxamide.
| Compound Name | N-[2-[4-chloro-3-(trifluoromethyl)phenoxy]ethyl]-2-methyl-6-(propanoylamino)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 142503824 |
| Molecular Formula | C19H19ClF3N3O3 |
| Molecular Weight | 429.83 g/mol |
| Exact Mass | 429.11 |
| IUPAC Name | N-[2-[4-chloro-3-(trifluoromethyl)phenoxy]ethyl]-2-methyl-6-(propanoylamino)pyridine-4-carboxamide |
| SMILES | CCC(=O)Nc1cc(C(=O)NCCOc2ccc(Cl)c(C(F)(F)F)c2)cc(C)n1 |
| InChI | InChI=1S/C19H19ClF3N3O3/c1-3-17(27)26-16-9-12(8-11(2)25-16)18(28)24-6-7-29-13-4-5-15(20)14(10-13)19(21,22)23/h4-5,8-10H,3,6-7H2,1-2H3,(H,24,28)(H,25,26,27) |
| InChIKey | FJHFHBGNURQCIO-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.83 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|