C18H17F4N3O3 — CID 142503790
2-acetamido-N-[2-[2-fluoro-4-(trifluoromethyl)phenoxy]ethyl]-6-methylpyridine-4-carboxamide (PubChem CID 142503790) has the molecular formula C18H17F4N3O3 and a molecular weight of 399.34 g/mol. Its IUPAC name is 2-acetamido-N-[2-[2-fluoro-4-(trifluoromethyl)phenoxy]ethyl]-6-methylpyridine-4-carboxamide.
| Compound Name | 2-acetamido-N-[2-[2-fluoro-4-(trifluoromethyl)phenoxy]ethyl]-6-methylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 142503790 |
| Molecular Formula | C18H17F4N3O3 |
| Molecular Weight | 399.34 g/mol |
| Exact Mass | 399.12 |
| IUPAC Name | 2-acetamido-N-[2-[2-fluoro-4-(trifluoromethyl)phenoxy]ethyl]-6-methylpyridine-4-carboxamide |
| SMILES | CC(=O)Nc1cc(C(=O)NCCOc2ccc(C(F)(F)F)cc2F)cc(C)n1 |
| InChI | InChI=1S/C18H17F4N3O3/c1-10-7-12(8-16(24-10)25-11(2)26)17(27)23-5-6-28-15-4-3-13(9-14(15)19)18(20,21)22/h3-4,7-9H,5-6H2,1-2H3,(H,23,27)(H,24,25,26) |
| InChIKey | DRUCURGWFYIJSL-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.34 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|