C20H21ClF3N3O3 — CID 142503885
N-[2-[2-chloro-5-(trifluoromethyl)phenoxy]ethyl]-2-methyl-6-(2-methylpropanoylamino)pyridine-4-carboxamide (PubChem CID 142503885) has the molecular formula C20H21ClF3N3O3 and a molecular weight of 443.85 g/mol. Its IUPAC name is N-[2-[2-chloro-5-(trifluoromethyl)phenoxy]ethyl]-2-methyl-6-(2-methylpropanoylamino)pyridine-4-carboxamide.
| Compound Name | N-[2-[2-chloro-5-(trifluoromethyl)phenoxy]ethyl]-2-methyl-6-(2-methylpropanoylamino)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 142503885 |
| Molecular Formula | C20H21ClF3N3O3 |
| Molecular Weight | 443.85 g/mol |
| Exact Mass | 443.12 |
| IUPAC Name | N-[2-[2-chloro-5-(trifluoromethyl)phenoxy]ethyl]-2-methyl-6-(2-methylpropanoylamino)pyridine-4-carboxamide |
| SMILES | Cc1cc(C(=O)NCCOc2cc(C(F)(F)F)ccc2Cl)cc(NC(=O)C(C)C)n1 |
| InChI | InChI=1S/C20H21ClF3N3O3/c1-11(2)18(28)27-17-9-13(8-12(3)26-17)19(29)25-6-7-30-16-10-14(20(22,23)24)4-5-15(16)21/h4-5,8-11H,6-7H2,1-3H3,(H,25,29)(H,26,27,28) |
| InChIKey | LYNHPBVPUBKINK-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.85 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|