C20H22F3N3O4 — CID 137368007
N-[2-[2-methoxy-4-(trifluoromethyl)phenoxy]ethyl]-2-(2-methylpropanoylamino)pyridine-4-carboxamide (PubChem CID 137368007) has the molecular formula C20H22F3N3O4 and a molecular weight of 425.41 g/mol. Its IUPAC name is N-[2-[2-methoxy-4-(trifluoromethyl)phenoxy]ethyl]-2-(2-methylpropanoylamino)pyridine-4-carboxamide.
| Compound Name | N-[2-[2-methoxy-4-(trifluoromethyl)phenoxy]ethyl]-2-(2-methylpropanoylamino)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 137368007 |
| Molecular Formula | C20H22F3N3O4 |
| Molecular Weight | 425.41 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | N-[2-[2-methoxy-4-(trifluoromethyl)phenoxy]ethyl]-2-(2-methylpropanoylamino)pyridine-4-carboxamide |
| SMILES | COc1cc(C(F)(F)F)ccc1OCCNC(=O)c1ccnc(NC(=O)C(C)C)c1 |
| InChI | InChI=1S/C20H22F3N3O4/c1-12(2)18(27)26-17-10-13(6-7-24-17)19(28)25-8-9-30-15-5-4-14(20(21,22)23)11-16(15)29-3/h4-7,10-12H,8-9H2,1-3H3,(H,25,28)(H,24,26,27) |
| InChIKey | RZLYOZWSIJRGSK-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.41 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|