C25H24F3N3O5 — CID 155407777
N-[2-[1-formyl-6-(2,2,2-trifluoroethoxy)naphthalen-2-yl]oxyethyl]-2-(2-methylpropanoylamino)pyridine-4-carboxamide (PubChem CID 155407777) has the molecular formula C25H24F3N3O5 and a molecular weight of 503.48 g/mol. Its IUPAC name is N-[2-[1-formyl-6-(2,2,2-trifluoroethoxy)naphthalen-2-yl]oxyethyl]-2-(2-methylpropanoylamino)pyridine-4-carboxamide.
| Compound Name | N-[2-[1-formyl-6-(2,2,2-trifluoroethoxy)naphthalen-2-yl]oxyethyl]-2-(2-methylpropanoylamino)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 155407777 |
| Molecular Formula | C25H24F3N3O5 |
| Molecular Weight | 503.48 g/mol |
| Exact Mass | 503.17 |
| IUPAC Name | N-[2-[1-formyl-6-(2,2,2-trifluoroethoxy)naphthalen-2-yl]oxyethyl]-2-(2-methylpropanoylamino)pyridine-4-carboxamide |
| SMILES | CC(C)C(=O)Nc1cc(C(=O)NCCOc2ccc3cc(OCC(F)(F)F)ccc3c2C=O)ccn1 |
| InChI | InChI=1S/C25H24F3N3O5/c1-15(2)23(33)31-22-12-17(7-8-29-22)24(34)30-9-10-35-21-6-3-16-11-18(36-14-25(26,27)28)4-5-19(16)20(21)13-32/h3-8,11-13,15H,9-10,14H2,1-2H3,(H,30,34)(H,29,31,33) |
| InChIKey | YHXIILLHSGRLHV-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 106.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.48 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|