C21H25F3N4O4 — CID 67510831
2-(2-methylpropanoylamino)-N-[1-[6-[2-(2,2,2-trifluoroethoxy)ethoxy]-3-pyridinyl]ethyl]pyridine-4-carboxamide (PubChem CID 67510831) has the molecular formula C21H25F3N4O4 and a molecular weight of 454.45 g/mol. Its IUPAC name is 2-(2-methylpropanoylamino)-N-[1-[6-[2-(2,2,2-trifluoroethoxy)ethoxy]-3-pyridinyl]ethyl]pyridine-4-carboxamide.
| Compound Name | 2-(2-methylpropanoylamino)-N-[1-[6-[2-(2,2,2-trifluoroethoxy)ethoxy]-3-pyridinyl]ethyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 67510831 |
| Molecular Formula | C21H25F3N4O4 |
| Molecular Weight | 454.45 g/mol |
| Exact Mass | 454.18 |
| IUPAC Name | 2-(2-methylpropanoylamino)-N-[1-[6-[2-(2,2,2-trifluoroethoxy)ethoxy]-3-pyridinyl]ethyl]pyridine-4-carboxamide |
| SMILES | CC(C)C(=O)Nc1cc(C(=O)NC(C)c2ccc(OCCOCC(F)(F)F)nc2)ccn1 |
| InChI | InChI=1S/C21H25F3N4O4/c1-13(2)19(29)28-17-10-15(6-7-25-17)20(30)27-14(3)16-4-5-18(26-11-16)32-9-8-31-12-21(22,23)24/h4-7,10-11,13-14H,8-9,12H2,1-3H3,(H,27,30)(H,25,28,29) |
| InChIKey | FFFLRXLAULXMJA-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 102.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.45 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|