C17H16F5N3O2 — CID 157284679
2-methyl-N-[1-[6-(2,2,3,3,3-pentafluoropropoxy)-3-pyridinyl]ethyl]pyridine-4-carboxamide (PubChem CID 157284679) has the molecular formula C17H16F5N3O2 and a molecular weight of 389.32 g/mol. Its IUPAC name is 2-methyl-N-[1-[6-(2,2,3,3,3-pentafluoropropoxy)-3-pyridinyl]ethyl]pyridine-4-carboxamide.
| Compound Name | 2-methyl-N-[1-[6-(2,2,3,3,3-pentafluoropropoxy)-3-pyridinyl]ethyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 157284679 |
| Molecular Formula | C17H16F5N3O2 |
| Molecular Weight | 389.32 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | 2-methyl-N-[1-[6-(2,2,3,3,3-pentafluoropropoxy)-3-pyridinyl]ethyl]pyridine-4-carboxamide |
| SMILES | Cc1cc(C(=O)NC(C)c2ccc(OCC(F)(F)C(F)(F)F)nc2)ccn1 |
| InChI | InChI=1S/C17H16F5N3O2/c1-10-7-12(5-6-23-10)15(26)25-11(2)13-3-4-14(24-8-13)27-9-16(18,19)17(20,21)22/h3-8,11H,9H2,1-2H3,(H,25,26) |
| InChIKey | DSGVZUSVXLCSTA-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.32 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|