C16H15BrF3N3O2 — CID 87426946
2-bromo-6-methyl-N-[1-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]ethyl]pyridine-4-carboxamide (PubChem CID 87426946) has the molecular formula C16H15BrF3N3O2 and a molecular weight of 418.21 g/mol. Its IUPAC name is 2-bromo-6-methyl-N-[1-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]ethyl]pyridine-4-carboxamide.
| Compound Name | 2-bromo-6-methyl-N-[1-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]ethyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 87426946 |
| Molecular Formula | C16H15BrF3N3O2 |
| Molecular Weight | 418.21 g/mol |
| Exact Mass | 417.03 |
| IUPAC Name | 2-bromo-6-methyl-N-[1-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]ethyl]pyridine-4-carboxamide |
| SMILES | Cc1cc(C(=O)NC(C)c2ccc(OCC(F)(F)F)nc2)cc(Br)n1 |
| InChI | InChI=1S/C16H15BrF3N3O2/c1-9-5-12(6-13(17)22-9)15(24)23-10(2)11-3-4-14(21-7-11)25-8-16(18,19)20/h3-7,10H,8H2,1-2H3,(H,23,24) |
| InChIKey | UAYPSECJVASYMA-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.21 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|