C20H21F5N4O3 — CID 87427280
2-(2-methylpropanoylamino)-N-[1-[6-(2,2,3,3,3-pentafluoropropoxy)-3-pyridinyl]ethyl]pyridine-4-carboxamide (PubChem CID 87427280) has the molecular formula C20H21F5N4O3 and a molecular weight of 460.40 g/mol. Its IUPAC name is 2-(2-methylpropanoylamino)-N-[1-[6-(2,2,3,3,3-pentafluoropropoxy)-3-pyridinyl]ethyl]pyridine-4-carboxamide.
| Compound Name | 2-(2-methylpropanoylamino)-N-[1-[6-(2,2,3,3,3-pentafluoropropoxy)-3-pyridinyl]ethyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 87427280 |
| Molecular Formula | C20H21F5N4O3 |
| Molecular Weight | 460.40 g/mol |
| Exact Mass | 460.15 |
| IUPAC Name | 2-(2-methylpropanoylamino)-N-[1-[6-(2,2,3,3,3-pentafluoropropoxy)-3-pyridinyl]ethyl]pyridine-4-carboxamide |
| SMILES | CC(C)C(=O)Nc1cc(C(=O)NC(C)c2ccc(OCC(F)(F)C(F)(F)F)nc2)ccn1 |
| InChI | InChI=1S/C20H21F5N4O3/c1-11(2)17(30)29-15-8-13(6-7-26-15)18(31)28-12(3)14-4-5-16(27-9-14)32-10-19(21,22)20(23,24)25/h4-9,11-12H,10H2,1-3H3,(H,28,31)(H,26,29,30) |
| InChIKey | WZISMZPJUMFCLI-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.40 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|