C18H18F3IN4O3 — CID 69087823
2-acetamido-N-[1-[5-(iodomethyl)-6-(2,2,2-trifluoroethoxy)-3-pyridinyl]ethyl]pyridine-4-carboxamide (PubChem CID 69087823) has the molecular formula C18H18F3IN4O3 and a molecular weight of 522.27 g/mol. Its IUPAC name is 2-acetamido-N-[1-[5-(iodomethyl)-6-(2,2,2-trifluoroethoxy)-3-pyridinyl]ethyl]pyridine-4-carboxamide.
| Compound Name | 2-acetamido-N-[1-[5-(iodomethyl)-6-(2,2,2-trifluoroethoxy)-3-pyridinyl]ethyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 69087823 |
| Molecular Formula | C18H18F3IN4O3 |
| Molecular Weight | 522.27 g/mol |
| Exact Mass | 522.04 |
| IUPAC Name | 2-acetamido-N-[1-[5-(iodomethyl)-6-(2,2,2-trifluoroethoxy)-3-pyridinyl]ethyl]pyridine-4-carboxamide |
| SMILES | CC(=O)Nc1cc(C(=O)NC(C)c2cnc(OCC(F)(F)F)c(CI)c2)ccn1 |
| InChI | InChI=1S/C18H18F3IN4O3/c1-10(25-16(28)12-3-4-23-15(6-12)26-11(2)27)14-5-13(7-22)17(24-8-14)29-9-18(19,20)21/h3-6,8,10H,7,9H2,1-2H3,(H,25,28)(H,23,26,27) |
| InChIKey | YBOHNUOLUIXNTQ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.27 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|