C15H14F3NO4 — CID 150441026
2-[6-(2,2,2-trifluoroethoxy)naphthalen-2-yl]oxyethylcarbamic acid (PubChem CID 150441026) has the molecular formula C15H14F3NO4 and a molecular weight of 329.27 g/mol. Its IUPAC name is 2-[6-(2,2,2-trifluoroethoxy)naphthalen-2-yl]oxyethylcarbamic acid.
| Compound Name | 2-[6-(2,2,2-trifluoroethoxy)naphthalen-2-yl]oxyethylcarbamic acid |
|---|---|
| PubChem CID | 150441026 |
| Molecular Formula | C15H14F3NO4 |
| Molecular Weight | 329.27 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | 2-[6-(2,2,2-trifluoroethoxy)naphthalen-2-yl]oxyethylcarbamic acid |
| SMILES | O=C(O)NCCOc1ccc2cc(OCC(F)(F)F)ccc2c1 |
| InChI | InChI=1S/C15H14F3NO4/c16-15(17,18)9-23-13-4-2-10-7-12(3-1-11(10)8-13)22-6-5-19-14(20)21/h1-4,7-8,19H,5-6,9H2,(H,20,21) |
| InChIKey | HLTUEQQOXWCYCS-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.27 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|