C14H16F6N2O3 — CID 78878567
1-[2-(2,2,2-trifluoroethoxy)ethyl]-3-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]urea (PubChem CID 78878567) has the molecular formula C14H16F6N2O3 and a molecular weight of 374.28 g/mol. Its IUPAC name is 1-[2-(2,2,2-trifluoroethoxy)ethyl]-3-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]urea.
| Compound Name | 1-[2-(2,2,2-trifluoroethoxy)ethyl]-3-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]urea |
|---|---|
| PubChem CID | 78878567 |
| Molecular Formula | C14H16F6N2O3 |
| Molecular Weight | 374.28 g/mol |
| Exact Mass | 374.11 |
| IUPAC Name | 1-[2-(2,2,2-trifluoroethoxy)ethyl]-3-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]urea |
| SMILES | O=C(NCCOCC(F)(F)F)NCc1ccc(OCC(F)(F)F)cc1 |
| InChI | InChI=1S/C14H16F6N2O3/c15-13(16,17)8-24-6-5-21-12(23)22-7-10-1-3-11(4-2-10)25-9-14(18,19)20/h1-4H,5-9H2,(H2,21,22,23) |
| InChIKey | UGTCIRUXTMEEQY-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.28 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|