C11H11BrF3NO2 — CID 55257440
2-bromo-N-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]acetamide (PubChem CID 55257440) has the molecular formula C11H11BrF3NO2 and a molecular weight of 326.11 g/mol. Its IUPAC name is 2-bromo-N-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]acetamide.
| Compound Name | 2-bromo-N-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 55257440 |
| Molecular Formula | C11H11BrF3NO2 |
| Molecular Weight | 326.11 g/mol |
| Exact Mass | 324.99 |
| IUPAC Name | 2-bromo-N-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]acetamide |
| SMILES | O=C(CBr)NCc1ccc(OCC(F)(F)F)cc1 |
| InChI | InChI=1S/C11H11BrF3NO2/c12-5-10(17)16-6-8-1-3-9(4-2-8)18-7-11(13,14)15/h1-4H,5-7H2,(H,16,17) |
| InChIKey | SGWJCZGIEAXMGK-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.11 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|