C12H8BF6O- — CID 63677265
trifluoro-[6-(2,2,2-trifluoroethoxy)naphthalen-2-yl]boranuide (PubChem CID 63677265) has the molecular formula C12H8BF6O- and a molecular weight of 293.00 g/mol. Its IUPAC name is trifluoro-[6-(2,2,2-trifluoroethoxy)naphthalen-2-yl]boranuide.
| Compound Name | trifluoro-[6-(2,2,2-trifluoroethoxy)naphthalen-2-yl]boranuide |
|---|---|
| PubChem CID | 63677265 |
| Molecular Formula | C12H8BF6O- |
| Molecular Weight | 293.00 g/mol |
| Exact Mass | 293.06 |
| IUPAC Name | trifluoro-[6-(2,2,2-trifluoroethoxy)naphthalen-2-yl]boranuide |
| SMILES | F[B-](F)(F)c1ccc2cc(OCC(F)(F)F)ccc2c1 |
| InChI | InChI=1S/C12H8BF6O/c14-12(15,16)7-20-11-4-2-8-5-10(13(17,18)19)3-1-9(8)6-11/h1-6H,7H2/q-1 |
| InChIKey | QCPFMJPQJMPZCO-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.00 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|