C22H19F3O2 — CID 139856089
2-(4-but-2-enoxyphenyl)-6-(2,2,2-trifluoroethoxy)naphthalene (PubChem CID 139856089) has the molecular formula C22H19F3O2 and a molecular weight of 372.39 g/mol. Its IUPAC name is 2-(4-but-2-enoxyphenyl)-6-(2,2,2-trifluoroethoxy)naphthalene.
| Compound Name | 2-(4-but-2-enoxyphenyl)-6-(2,2,2-trifluoroethoxy)naphthalene |
|---|---|
| PubChem CID | 139856089 |
| Molecular Formula | C22H19F3O2 |
| Molecular Weight | 372.39 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | 2-(4-but-2-enoxyphenyl)-6-(2,2,2-trifluoroethoxy)naphthalene |
| SMILES | CC=CCOc1ccc(-c2ccc3cc(OCC(F)(F)F)ccc3c2)cc1 |
| InChI | InChI=1S/C22H19F3O2/c1-2-3-12-26-20-9-6-16(7-10-20)17-4-5-19-14-21(11-8-18(19)13-17)27-15-22(23,24)25/h2-11,13-14H,12,15H2,1H3 |
| InChIKey | MWHBUCVPDKITKB-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.39 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|