C23H18F6O3 — CID 139856337
6-[(4-but-2-enoxyphenyl)-difluoromethoxy]-1-fluoro-2-(2,2,2-trifluoroethoxy)naphthalene (PubChem CID 139856337) has the molecular formula C23H18F6O3 and a molecular weight of 456.38 g/mol. Its IUPAC name is 6-[(4-but-2-enoxyphenyl)-difluoromethoxy]-1-fluoro-2-(2,2,2-trifluoroethoxy)naphthalene.
| Compound Name | 6-[(4-but-2-enoxyphenyl)-difluoromethoxy]-1-fluoro-2-(2,2,2-trifluoroethoxy)naphthalene |
|---|---|
| PubChem CID | 139856337 |
| Molecular Formula | C23H18F6O3 |
| Molecular Weight | 456.38 g/mol |
| Exact Mass | 456.12 |
| IUPAC Name | 6-[(4-but-2-enoxyphenyl)-difluoromethoxy]-1-fluoro-2-(2,2,2-trifluoroethoxy)naphthalene |
| SMILES | CC=CCOc1ccc(C(F)(F)Oc2ccc3c(F)c(OCC(F)(F)F)ccc3c2)cc1 |
| InChI | InChI=1S/C23H18F6O3/c1-2-3-12-30-17-7-5-16(6-8-17)23(28,29)32-18-9-10-19-15(13-18)4-11-20(21(19)24)31-14-22(25,26)27/h2-11,13H,12,14H2,1H3 |
| InChIKey | VXDXBCQKRIJVIG-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.38 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|