C26H27F3O2 — CID 139862460
2-[[4-[(E)-but-2-enoxy]phenyl]-difluoromethoxy]-3-fluoro-6-pentylnaphthalene (PubChem CID 139862460) has the molecular formula C26H27F3O2 and a molecular weight of 428.49 g/mol. Its IUPAC name is 2-[[4-[(E)-but-2-enoxy]phenyl]-difluoromethoxy]-3-fluoro-6-pentylnaphthalene.
| Compound Name | 2-[[4-[(E)-but-2-enoxy]phenyl]-difluoromethoxy]-3-fluoro-6-pentylnaphthalene |
|---|---|
| PubChem CID | 139862460 |
| Molecular Formula | C26H27F3O2 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.20 |
| IUPAC Name | 2-[[4-[(E)-but-2-enoxy]phenyl]-difluoromethoxy]-3-fluoro-6-pentylnaphthalene |
| SMILES | C/C=C/COc1ccc(C(F)(F)Oc2cc3ccc(CCCCC)cc3cc2F)cc1 |
| InChI | InChI=1S/C26H27F3O2/c1-3-5-7-8-19-9-10-20-18-25(24(27)17-21(20)16-19)31-26(28,29)22-11-13-23(14-12-22)30-15-6-4-2/h4,6,9-14,16-18H,3,5,7-8,15H2,1-2H3/b6-4+ |
| InChIKey | QAAIFKLGGFEXER-GQCTYLIASA-N |
| XLogP | 7.79 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|