C24H23F3O2 — CID 139863155
2-[[4-[(E)-but-2-enoxy]phenyl]-difluoromethoxy]-3-fluoro-6-propylnaphthalene (PubChem CID 139863155) has the molecular formula C24H23F3O2 and a molecular weight of 400.44 g/mol. Its IUPAC name is 2-[[4-[(E)-but-2-enoxy]phenyl]-difluoromethoxy]-3-fluoro-6-propylnaphthalene.
| Compound Name | 2-[[4-[(E)-but-2-enoxy]phenyl]-difluoromethoxy]-3-fluoro-6-propylnaphthalene |
|---|---|
| PubChem CID | 139863155 |
| Molecular Formula | C24H23F3O2 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | 2-[[4-[(E)-but-2-enoxy]phenyl]-difluoromethoxy]-3-fluoro-6-propylnaphthalene |
| SMILES | C/C=C/COc1ccc(C(F)(F)Oc2cc3ccc(CCC)cc3cc2F)cc1 |
| InChI | InChI=1S/C24H23F3O2/c1-3-5-13-28-21-11-9-20(10-12-21)24(26,27)29-23-16-18-8-7-17(6-4-2)14-19(18)15-22(23)25/h3,5,7-12,14-16H,4,6,13H2,1-2H3/b5-3+ |
| InChIKey | DQRBLLAXFWVYBU-HWKANZROSA-N |
| XLogP | 7.01 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|