C23H26O — CID 70371640
1-but-2-enoxy-4-[2-(4-pentylphenyl)ethynyl]benzene (PubChem CID 70371640) has the molecular formula C23H26O and a molecular weight of 318.46 g/mol. Its IUPAC name is 1-but-2-enoxy-4-[2-(4-pentylphenyl)ethynyl]benzene.
| Compound Name | 1-but-2-enoxy-4-[2-(4-pentylphenyl)ethynyl]benzene |
|---|---|
| PubChem CID | 70371640 |
| Molecular Formula | C23H26O |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.20 |
| IUPAC Name | 1-but-2-enoxy-4-[2-(4-pentylphenyl)ethynyl]benzene |
| SMILES | CC=CCOc1ccc(C#Cc2ccc(CCCCC)cc2)cc1 |
| InChI | InChI=1S/C23H26O/c1-3-5-7-8-20-9-11-21(12-10-20)13-14-22-15-17-23(18-16-22)24-19-6-4-2/h4,6,9-12,15-18H,3,5,7-8,19H2,1-2H3 |
| InChIKey | BVMNBWSIFGJHLZ-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|